C13H14N4O8 — CID 92528632
[(3R,5S)-3,5-diacetyloxy-1,7-didiazo-2,6-dioxoheptan-4-yl] acetate (PubChem CID 92528632) has the molecular formula C13H14N4O8 and a molecular weight of 354.28 g/mol. Its IUPAC name is [(3R,5S)-3,5-diacetyloxy-1,7-didiazo-2,6-dioxoheptan-4-yl] acetate.
| Compound Name | [(3R,5S)-3,5-diacetyloxy-1,7-didiazo-2,6-dioxoheptan-4-yl] acetate |
|---|---|
| PubChem CID | 92528632 |
| Molecular Formula | C13H14N4O8 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [(3R,5S)-3,5-diacetyloxy-1,7-didiazo-2,6-dioxoheptan-4-yl] acetate |
| SMILES | CC(=O)OC([C@H](OC(C)=O)C(=O)C=[N+]=[N-])[C@@H](OC(C)=O)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C13H14N4O8/c1-6(18)23-11(9(21)4-16-14)13(25-8(3)20)12(24-7(2)19)10(22)5-17-15/h4-5,11-13H,1-3H3/t11-,12+,13? |
| InChIKey | PWMLOHHAGDIDHP-FUNVUKJBSA-N |
| XLogP | -1.48 |
| TPSA | 185.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|