C7H10N2O2 — CID 71363060
1-diazo-3,3-dimethylpentane-2,4-dione (PubChem CID 71363060) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-diazo-3,3-dimethylpentane-2,4-dione.
| Compound Name | 1-diazo-3,3-dimethylpentane-2,4-dione |
|---|---|
| PubChem CID | 71363060 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-diazo-3,3-dimethylpentane-2,4-dione |
| SMILES | CC(=O)C(C)(C)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C7H10N2O2/c1-5(10)7(2,3)6(11)4-9-8/h4H,1-3H3 |
| InChIKey | HSSGXKXIDSIVOI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|