C11H19N3O4 — CID 91533532
[(3R,4S)-1-diazo-3-methyl-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamic acid (PubChem CID 91533532) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(3R,4S)-1-diazo-3-methyl-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamic acid.
| Compound Name | [(3R,4S)-1-diazo-3-methyl-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 91533532 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [(3R,4S)-1-diazo-3-methyl-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamic acid |
| SMILES | C[C@H](OC(C)(C)C)[C@@](C)(NC(=O)O)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C11H19N3O4/c1-7(18-10(2,3)4)11(5,14-9(16)17)8(15)6-13-12/h6-7,14H,1-5H3,(H,16,17)/t7-,11+/m0/s1 |
| InChIKey | KLUGFROZYCESJI-WRWORJQWSA-N |
| XLogP | 1.09 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|