C12H18N2O — CID 102078776
1-diazo-3,3,7,7-tetramethyloct-5-yn-2-one (PubChem CID 102078776) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-diazo-3,3,7,7-tetramethyloct-5-yn-2-one.
| Compound Name | 1-diazo-3,3,7,7-tetramethyloct-5-yn-2-one |
|---|---|
| PubChem CID | 102078776 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-diazo-3,3,7,7-tetramethyloct-5-yn-2-one |
| SMILES | CC(C)(C)C#CCC(C)(C)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C12H18N2O/c1-11(2,3)7-6-8-12(4,5)10(15)9-14-13/h9H,8H2,1-5H3 |
| InChIKey | AXWGWVFCRHUOCD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|