C13H22O — CID 130478596
7,7-dimethyl-3-propan-2-yloct-5-yn-2-one (PubChem CID 130478596) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 7,7-dimethyl-3-propan-2-yloct-5-yn-2-one.
| Compound Name | 7,7-dimethyl-3-propan-2-yloct-5-yn-2-one |
|---|---|
| PubChem CID | 130478596 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 7,7-dimethyl-3-propan-2-yloct-5-yn-2-one |
| SMILES | CC(=O)C(CC#CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H22O/c1-10(2)12(11(3)14)8-7-9-13(4,5)6/h10,12H,8H2,1-6H3 |
| InChIKey | AHRTVZYFHOEQDP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|