C11H21NO3 — CID 155600204
[(4S)-4-acetyl-2,5-dimethylhexan-2-yl] carbamate (PubChem CID 155600204) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is [(4S)-4-acetyl-2,5-dimethylhexan-2-yl] carbamate.
| Compound Name | [(4S)-4-acetyl-2,5-dimethylhexan-2-yl] carbamate |
|---|---|
| PubChem CID | 155600204 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | [(4S)-4-acetyl-2,5-dimethylhexan-2-yl] carbamate |
| SMILES | CC(=O)[C@@H](CC(C)(C)OC(N)=O)C(C)C |
| InChI | InChI=1S/C11H21NO3/c1-7(2)9(8(3)13)6-11(4,5)15-10(12)14/h7,9H,6H2,1-5H3,(H2,12,14)/t9-/m0/s1 |
| InChIKey | UKXUHQFHMXKJSQ-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |