C14H25NO4 — CID 174753969
[2,6-dimethyl-4-[(3R)-3-methyloxirane-2-carbonyl]heptan-2-yl] carbamate (PubChem CID 174753969) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is [2,6-dimethyl-4-[(3R)-3-methyloxirane-2-carbonyl]heptan-2-yl] carbamate.
| Compound Name | [2,6-dimethyl-4-[(3R)-3-methyloxirane-2-carbonyl]heptan-2-yl] carbamate |
|---|---|
| PubChem CID | 174753969 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | [2,6-dimethyl-4-[(3R)-3-methyloxirane-2-carbonyl]heptan-2-yl] carbamate |
| SMILES | CC(C)CC(CC(C)(C)OC(N)=O)C(=O)C1O[C@@H]1C |
| InChI | InChI=1S/C14H25NO4/c1-8(2)6-10(11(16)12-9(3)18-12)7-14(4,5)19-13(15)17/h8-10,12H,6-7H2,1-5H3,(H2,15,17)/t9-,10?,12?/m1/s1 |
| InChIKey | GFQDFMSNQAGZKY-GRZMOONWSA-N |
| XLogP | 2.27 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|