C21H32O6 — CID 132574868
3,3,8,8,13,13-hexamethylpentadecane-2,4,7,9,12,14-hexone (PubChem CID 132574868) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3,3,8,8,13,13-hexamethylpentadecane-2,4,7,9,12,14-hexone.
| Compound Name | 3,3,8,8,13,13-hexamethylpentadecane-2,4,7,9,12,14-hexone |
|---|---|
| PubChem CID | 132574868 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3,3,8,8,13,13-hexamethylpentadecane-2,4,7,9,12,14-hexone |
| SMILES | CC(=O)C(C)(C)C(=O)CCC(=O)C(C)(C)C(=O)CCC(=O)C(C)(C)C(C)=O |
| InChI | InChI=1S/C21H32O6/c1-13(22)19(3,4)15(24)9-11-17(26)21(7,8)18(27)12-10-16(25)20(5,6)14(2)23/h9-12H2,1-8H3 |
| InChIKey | AFSXGLZAPVJGIA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|