C7H9NO3S3 — CID 24757998
2-acetamido-3-methanethioyl-3-sulfanyl-4-sulfanylidenebutanoic acid (PubChem CID 24757998) has the molecular formula C7H9NO3S3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-acetamido-3-methanethioyl-3-sulfanyl-4-sulfanylidenebutanoic acid.
| Compound Name | 2-acetamido-3-methanethioyl-3-sulfanyl-4-sulfanylidenebutanoic acid |
|---|---|
| PubChem CID | 24757998 |
| Molecular Formula | C7H9NO3S3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 2-acetamido-3-methanethioyl-3-sulfanyl-4-sulfanylidenebutanoic acid |
| SMILES | CC(=O)NC(C(=O)O)C(S)(C=S)C=S |
| InChI | InChI=1S/C7H9NO3S3/c1-4(9)8-5(6(10)11)7(14,2-12)3-13/h2-3,5,14H,1H3,(H,8,9)(H,10,11) |
| InChIKey | DGEUSUXNEZHYNG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|