C14H24N2O5S2 — CID 159680605
(2S)-2-acetamido-3-methyl-3-sulfanylbutanoic acid;N-[(3R)-2,2-dimethyl-4-oxothietan-3-yl]acetamide (PubChem CID 159680605) has the molecular formula C14H24N2O5S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2S)-2-acetamido-3-methyl-3-sulfanylbutanoic acid;N-[(3R)-2,2-dimethyl-4-oxothietan-3-yl]acetamide.
| Compound Name | (2S)-2-acetamido-3-methyl-3-sulfanylbutanoic acid;N-[(3R)-2,2-dimethyl-4-oxothietan-3-yl]acetamide |
|---|---|
| PubChem CID | 159680605 |
| Molecular Formula | C14H24N2O5S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-2-acetamido-3-methyl-3-sulfanylbutanoic acid;N-[(3R)-2,2-dimethyl-4-oxothietan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)O)C(C)(C)S.CC(=O)N[C@H]1C(=O)SC1(C)C |
| InChI | InChI=1S/C7H13NO3S.C7H11NO2S/c1-4(9)8-5(6(10)11)7(2,3)12;1-4(9)8-5-6(10)11-7(5,2)3/h5,12H,1-3H3,(H,8,9)(H,10,11);5H,1-3H3,(H,8,9)/t2*5-/m00/s1 |
| InChIKey | MVDVTEHFVMVGOM-ZLELNMGESA-N |
| XLogP | 0.83 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|