C8H16N2O3S — CID 140856847
(2R)-2-[[acetamido(deuterio)methyl]amino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 140856847) has the molecular formula C8H16N2O3S and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R)-2-[[acetamido(deuterio)methyl]amino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[[acetamido(deuterio)methyl]amino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 140856847 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (2R)-2-[[acetamido(deuterio)methyl]amino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | [2H]C(NC(C)=O)N[C@H](C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C8H16N2O3S/c1-5(11)9-4-10-6(7(12)13)8(2,3)14/h6,10,14H,4H2,1-3H3,(H,9,11)(H,12,13)/t6-/m1/s1/i4D/t4?,6- |
| InChIKey | WZBZWKXRUZKOHH-OZWRGUNTSA-N |
| XLogP | -0.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|