C10H19NO3S — CID 16775212
2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid (PubChem CID 16775212) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 16775212 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(C)C(=O)NC(C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C10H19NO3S/c1-9(2,3)8(14)11-6(7(12)13)10(4,5)15/h6,15H,1-5H3,(H,11,14)(H,12,13) |
| InChIKey | YNYKZYXNPJXWIS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|