About 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid
2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid (PubChem CID 16775212) has the molecular formula C10H19NO3S
and a molecular weight of 233.33 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid |
| PubChem CID | 16775212 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(C)C(=O)NC(C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C10H19NO3S/c1-9(2,3)8(14)11-6(7(12)13)10(4,5)15/h6,15H,1-5H3,(H,11,14)(H,12,13) |
| InChIKey | YNYKZYXNPJXWIS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid (CID 16775212) is 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid is CC(C)(C)C(=O)NC(C(=O)O)C(C)(C)S.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid?
The InChIKey is YNYKZYXNPJXWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3S/c1-9(2,3)8(14)11-6(7(12)13)10(4,5)15/h6,15H,1-5H3,(H,11,14)(H,12,13).
What are the key properties of 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid?
2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid has a molecular weight of 233.33 g/mol, XLogP of 1.31, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)-3-methyl-3-sulfanylbutanoic acid is sourced from PubChem (CID 16775212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).