C10H13N3O3S — CID 16770561
3-methyl-2-(pyrazine-2-carbonylamino)-3-sulfanylbutanoic acid (PubChem CID 16770561) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 3-methyl-2-(pyrazine-2-carbonylamino)-3-sulfanylbutanoic acid.
| Compound Name | 3-methyl-2-(pyrazine-2-carbonylamino)-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 16770561 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-methyl-2-(pyrazine-2-carbonylamino)-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)C(NC(=O)c1cnccn1)C(=O)O |
| InChI | InChI=1S/C10H13N3O3S/c1-10(2,17)7(9(15)16)13-8(14)6-5-11-3-4-12-6/h3-5,7,17H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | AVPNOBGWWTZKEP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|