C9H11N3O4 — CID 107822419
(2S)-4-hydroxy-2-(pyrazine-2-carbonylamino)butanoic acid (PubChem CID 107822419) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(pyrazine-2-carbonylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(pyrazine-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 107822419 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (2S)-4-hydroxy-2-(pyrazine-2-carbonylamino)butanoic acid |
| SMILES | O=C(N[C@@H](CCO)C(=O)O)c1cnccn1 |
| InChI | InChI=1S/C9H11N3O4/c13-4-1-6(9(15)16)12-8(14)7-5-10-2-3-11-7/h2-3,5-6,13H,1,4H2,(H,12,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | BOLGYYSVWBCHGG-LURJTMIESA-N |
| XLogP | -0.96 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |