C11H13N3O5 — CID 82786676
5-methoxy-5-oxo-2-(pyrazine-2-carbonylamino)pentanoic acid (PubChem CID 82786676) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 5-methoxy-5-oxo-2-(pyrazine-2-carbonylamino)pentanoic acid.
| Compound Name | 5-methoxy-5-oxo-2-(pyrazine-2-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 82786676 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-methoxy-5-oxo-2-(pyrazine-2-carbonylamino)pentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)c1cnccn1)C(=O)O |
| InChI | InChI=1S/C11H13N3O5/c1-19-9(15)3-2-7(11(17)18)14-10(16)8-6-12-4-5-13-8/h4-7H,2-3H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | JUPNACBKQGUODN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |