C12H14N2O5 — CID 82786131
5-methoxy-5-oxo-2-(pyridine-2-carbonylamino)pentanoic acid (PubChem CID 82786131) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-methoxy-5-oxo-2-(pyridine-2-carbonylamino)pentanoic acid.
| Compound Name | 5-methoxy-5-oxo-2-(pyridine-2-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 82786131 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-methoxy-5-oxo-2-(pyridine-2-carbonylamino)pentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)c1ccccn1)C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c1-19-10(15)6-5-9(12(17)18)14-11(16)8-4-2-3-7-13-8/h2-4,7,9H,5-6H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | SFJAVEKTYJIXPX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |