C10H13N3O5 — CID 107820339
(2S)-5-methoxy-5-oxo-2-(1H-pyrazole-5-carbonylamino)pentanoic acid (PubChem CID 107820339) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2S)-5-methoxy-5-oxo-2-(1H-pyrazole-5-carbonylamino)pentanoic acid.
| Compound Name | (2S)-5-methoxy-5-oxo-2-(1H-pyrazole-5-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 107820339 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S)-5-methoxy-5-oxo-2-(1H-pyrazole-5-carbonylamino)pentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13N3O5/c1-18-8(14)3-2-7(10(16)17)12-9(15)6-4-5-11-13-6/h4-5,7H,2-3H2,1H3,(H,11,13)(H,12,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | LGFHTWVRNLICSH-ZETCQYMHSA-N |
| XLogP | -0.45 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |