C9H9N3O5 — CID 112733139
(2S)-2-(pyrazine-2-carbonylamino)butanedioic acid (PubChem CID 112733139) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is (2S)-2-(pyrazine-2-carbonylamino)butanedioic acid.
| Compound Name | (2S)-2-(pyrazine-2-carbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 112733139 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (2S)-2-(pyrazine-2-carbonylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1cnccn1)C(=O)O |
| InChI | InChI=1S/C9H9N3O5/c13-7(14)3-5(9(16)17)12-8(15)6-4-10-1-2-11-6/h1-2,4-5H,3H2,(H,12,15)(H,13,14)(H,16,17)/t5-/m0/s1 |
| InChIKey | IBGLAYYEXFBSEH-YFKPBYRVSA-N |
| XLogP | -0.87 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |