C12H15N3O3 — CID 162739047
(2S)-3-cyclobutyl-2-(pyrazine-2-carbonylamino)propanoic acid (PubChem CID 162739047) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-3-cyclobutyl-2-(pyrazine-2-carbonylamino)propanoic acid.
| Compound Name | (2S)-3-cyclobutyl-2-(pyrazine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 162739047 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2S)-3-cyclobutyl-2-(pyrazine-2-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](CC1CCC1)C(=O)O)c1cnccn1 |
| InChI | InChI=1S/C12H15N3O3/c16-11(10-7-13-4-5-14-10)15-9(12(17)18)6-8-2-1-3-8/h4-5,7-9H,1-3,6H2,(H,15,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | CYYANCYYVGKXHW-VIFPVBQESA-N |
| XLogP | 0.85 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |