C12H18N4O3 — CID 114264473
3-cyclohexyl-2-(2H-triazole-4-carbonylamino)propanoic acid (PubChem CID 114264473) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-cyclohexyl-2-(2H-triazole-4-carbonylamino)propanoic acid.
| Compound Name | 3-cyclohexyl-2-(2H-triazole-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 114264473 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-cyclohexyl-2-(2H-triazole-4-carbonylamino)propanoic acid |
| SMILES | O=C(NC(CC1CCCCC1)C(=O)O)c1cn[nH]n1 |
| InChI | InChI=1S/C12H18N4O3/c17-11(10-7-13-16-15-10)14-9(12(18)19)6-8-4-2-1-3-5-8/h7-9H,1-6H2,(H,14,17)(H,18,19)(H,13,15,16) |
| InChIKey | JWLBXNNMDSVNPO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |