About nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate
nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate (PubChem CID 88922467) has the molecular formula C7H12N2O4S
and a molecular weight of 220.25 g/mol. Its IUPAC name is nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate.
Molecular Properties
| Compound Name | nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate |
| PubChem CID | 88922467 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate |
| SMILES | CC(=O)N[C@@H](C(=O)ON=O)C(C)(C)S |
| InChI | InChI=1S/C7H12N2O4S/c1-4(10)8-5(7(2,3)14)6(11)13-9-12/h5,14H,1-3H3,(H,8,10)/t5-/m0/s1 |
| InChIKey | SSGBGFWZOONXIW-YFKPBYRVSA-N |
| XLogP | 0.42 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate?
The IUPAC name of nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate (CID 88922467) is nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate.
What is the SMILES notation for nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate?
The canonical SMILES for nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate is CC(=O)N[C@@H](C(=O)ON=O)C(C)(C)S.
What is the InChIKey of nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate?
The InChIKey is SSGBGFWZOONXIW-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H12N2O4S/c1-4(10)8-5(7(2,3)14)6(11)13-9-12/h5,14H,1-3H3,(H,8,10)/t5-/m0/s1.
What are the key properties of nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate?
nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate has a molecular weight of 220.25 g/mol, XLogP of 0.42, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso (2S)-2-acetamido-3-methyl-3-sulfanylbutanoate is sourced from PubChem (CID 88922467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).