C6H15N2O4PS — CID 87480080
[[(2R)-1-amino-3-methyl-1-oxo-3-sulfanylbutan-2-yl]amino]methylphosphonic acid (PubChem CID 87480080) has the molecular formula C6H15N2O4PS and a molecular weight of 242.24 g/mol. Its IUPAC name is [[(2R)-1-amino-3-methyl-1-oxo-3-sulfanylbutan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[(2R)-1-amino-3-methyl-1-oxo-3-sulfanylbutan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87480080 |
| Molecular Formula | C6H15N2O4PS |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | [[(2R)-1-amino-3-methyl-1-oxo-3-sulfanylbutan-2-yl]amino]methylphosphonic acid |
| SMILES | CC(C)(S)[C@H](NCP(=O)(O)O)C(N)=O |
| InChI | InChI=1S/C6H15N2O4PS/c1-6(2,14)4(5(7)9)8-3-13(10,11)12/h4,8,14H,3H2,1-2H3,(H2,7,9)(H2,10,11,12)/t4-/m1/s1 |
| InChIKey | HCPZSWQHQSLLCT-SCSAIBSYSA-N |
| XLogP | -0.73 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|