C7H17N2O4PS — CID 46931399
[[(2S)-1-amino-4-ethylsulfanyl-1-oxobutan-2-yl]amino]methylphosphonic acid (PubChem CID 46931399) has the molecular formula C7H17N2O4PS and a molecular weight of 256.26 g/mol. Its IUPAC name is [[(2S)-1-amino-4-ethylsulfanyl-1-oxobutan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[(2S)-1-amino-4-ethylsulfanyl-1-oxobutan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 46931399 |
| Molecular Formula | C7H17N2O4PS |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [[(2S)-1-amino-4-ethylsulfanyl-1-oxobutan-2-yl]amino]methylphosphonic acid |
| SMILES | CCSCC[C@H](NCP(=O)(O)O)C(N)=O |
| InChI | InChI=1S/C7H17N2O4PS/c1-2-15-4-3-6(7(8)10)9-5-14(11,12)13/h6,9H,2-5H2,1H3,(H2,8,10)(H2,11,12,13)/t6-/m0/s1 |
| InChIKey | ZAOMLXJWUZFJQE-LURJTMIESA-N |
| XLogP | -0.29 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|