C8H20N2O7P2S — CID 75242264
[(1-amino-4-ethylsulfanyl-1-oxobutan-2-yl)-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 75242264) has the molecular formula C8H20N2O7P2S and a molecular weight of 350.27 g/mol. Its IUPAC name is [(1-amino-4-ethylsulfanyl-1-oxobutan-2-yl)-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [(1-amino-4-ethylsulfanyl-1-oxobutan-2-yl)-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 75242264 |
| Molecular Formula | C8H20N2O7P2S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [(1-amino-4-ethylsulfanyl-1-oxobutan-2-yl)-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CCSCCC(C(N)=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N2O7P2S/c1-2-20-4-3-7(8(9)11)10(5-18(12,13)14)6-19(15,16)17/h7H,2-6H2,1H3,(H2,9,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | GLMHSKAGUJWCNO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|