About (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride
(2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride (PubChem CID 173356082) has the molecular formula C7H18ClNO2S2
and a molecular weight of 247.81 g/mol. Its IUPAC name is (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride.
Molecular Properties
| Compound Name | (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride |
| PubChem CID | 173356082 |
| Molecular Formula | C7H18ClNO2S2 |
| Molecular Weight | 247.81 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride |
| SMILES | CCSCC[C@H](NC)C(=O)O.Cl.S |
| InChI | InChI=1S/C7H15NO2S.ClH.H2S/c1-3-11-5-4-6(8-2)7(9)10;;/h6,8H,3-5H2,1-2H3,(H,9,10);1H;1H2/t6-;;/m0../s1 |
| InChIKey | NELWKUWPMKZDHR-ILKKLZGPSA-N |
| XLogP | 1.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride?
The IUPAC name of (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride (CID 173356082) is (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride.
What is the SMILES notation for (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride?
The canonical SMILES for (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride is CCSCC[C@H](NC)C(=O)O.Cl.S.
What is the InChIKey of (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride?
The InChIKey is NELWKUWPMKZDHR-ILKKLZGPSA-N. The full InChI is InChI=1S/C7H15NO2S.ClH.H2S/c1-3-11-5-4-6(8-2)7(9)10;;/h6,8H,3-5H2,1-2H3,(H,9,10);1H;1H2/t6-;;/m0../s1.
What are the key properties of (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride?
(2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride has a molecular weight of 247.81 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-ethylsulfanyl-2-(methylamino)butanoic acid;sulfane;hydrochloride is sourced from PubChem (CID 173356082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).