C6H10N2O5S — CID 139245360
3-acetamido-4-amino-2-hydroxy-4-oxo-2-sulfanylbutanoic acid (PubChem CID 139245360) has the molecular formula C6H10N2O5S and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-acetamido-4-amino-2-hydroxy-4-oxo-2-sulfanylbutanoic acid.
| Compound Name | 3-acetamido-4-amino-2-hydroxy-4-oxo-2-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 139245360 |
| Molecular Formula | C6H10N2O5S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 3-acetamido-4-amino-2-hydroxy-4-oxo-2-sulfanylbutanoic acid |
| SMILES | CC(=O)NC(C(N)=O)C(O)(S)C(=O)O |
| InChI | InChI=1S/C6H10N2O5S/c1-2(9)8-3(4(7)10)6(13,14)5(11)12/h3,13-14H,1H3,(H2,7,10)(H,8,9)(H,11,12) |
| InChIKey | BGOULWQVIZMEOQ-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|