C8H12N3O5 — CID 139245396
CID 139245396 (PubChem CID 139245396) has the molecular formula C8H12N3O5 and a molecular weight of 230.20 g/mol.
| Compound Name | CID 139245396 |
|---|---|
| PubChem CID | 139245396 |
| Molecular Formula | C8H12N3O5 |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | — |
| SMILES | CC(=O)NC([C](CC(N)=O)C(=O)O)C(N)=O |
| InChI | InChI=1S/C8H12N3O5/c1-3(12)11-6(7(10)14)4(8(15)16)2-5(9)13/h6H,2H2,1H3,(H2,9,13)(H2,10,14)(H,11,12)(H,15,16) |
| InChIKey | NFVBQUJSUOQBJR-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |