C11H24ClF — CID 167651170
1-chloro-1-fluoro-2,2-dimethylpropane;2,2-dimethylbutane (PubChem CID 167651170) has the molecular formula C11H24ClF and a molecular weight of 210.76 g/mol. Its IUPAC name is 1-chloro-1-fluoro-2,2-dimethylpropane;2,2-dimethylbutane.
| Compound Name | 1-chloro-1-fluoro-2,2-dimethylpropane;2,2-dimethylbutane |
|---|---|
| PubChem CID | 167651170 |
| Molecular Formula | C11H24ClF |
| Molecular Weight | 210.76 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-chloro-1-fluoro-2,2-dimethylpropane;2,2-dimethylbutane |
| SMILES | CC(C)(C)C(F)Cl.CCC(C)(C)C |
| InChI | InChI=1S/C6H14.C5H10ClF/c1-5-6(2,3)4;1-5(2,3)4(6)7/h5H2,1-4H3;4H,1-3H3 |
| InChIKey | QPKBUCSKIXWBPU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|