C12H28W — CID 157126936
bis(2,2-dimethylbutane);tungsten (PubChem CID 157126936) has the molecular formula C12H28W and a molecular weight of 356.20 g/mol. Its IUPAC name is bis(2,2-dimethylbutane);tungsten.
| Compound Name | bis(2,2-dimethylbutane);tungsten |
|---|---|
| PubChem CID | 157126936 |
| Molecular Formula | C12H28W |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | bis(2,2-dimethylbutane);tungsten |
| SMILES | CCC(C)(C)C.CCC(C)(C)C.[W] |
| InChI | InChI=1S/2C6H14.W/c2*1-5-6(2,3)4;/h2*5H2,1-4H3; |
| InChIKey | AIPORXACDRJWQI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |