C17H40 — CID 91438439
2,2-dimethylbutane;propane;2,3,3-trimethylpentane (PubChem CID 91438439) has the molecular formula C17H40 and a molecular weight of 244.51 g/mol. Its IUPAC name is 2,2-dimethylbutane;propane;2,3,3-trimethylpentane.
| Compound Name | 2,2-dimethylbutane;propane;2,3,3-trimethylpentane |
|---|---|
| PubChem CID | 91438439 |
| Molecular Formula | C17H40 |
| Molecular Weight | 244.51 g/mol |
| Exact Mass | 244.31 |
| IUPAC Name | 2,2-dimethylbutane;propane;2,3,3-trimethylpentane |
| SMILES | CCC.CCC(C)(C)C.CCC(C)(C)C(C)C |
| InChI | InChI=1S/C8H18.C6H14.C3H8/c1-6-8(4,5)7(2)3;1-5-6(2,3)4;1-3-2/h7H,6H2,1-5H3;5H2,1-4H3;3H2,1-2H3 |
| InChIKey | OYOYEPOSXCLGLL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |