C43H88 — CID 123648575
(12S)-12-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,14,14-pentacosamethylhexadecane (PubChem CID 123648575) has the molecular formula C43H88 and a molecular weight of 605.18 g/mol. Its IUPAC name is (12S)-12-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,14,14-pentacosamethylhexadecane.
| Compound Name | (12S)-12-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,14,14-pentacosamethylhexadecane |
|---|---|
| PubChem CID | 123648575 |
| Molecular Formula | C43H88 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.69 |
| IUPAC Name | (12S)-12-ethyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,14,14-pentacosamethylhexadecane |
| SMILES | CCC(C)(C)C(C)(C)[C@](C)(CC)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H88/c1-29-32(6,7)34(10,11)43(28,30-2)42(26,27)41(24,25)40(22,23)39(20,21)38(18,19)37(16,17)36(14,15)35(12,13)33(8,9)31(3,4)5/h29-30H2,1-28H3/t43-/m0/s1 |
| InChIKey | DWXRLXXMLNAOCO-QLKFWGTOSA-N |
| XLogP | 15.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |