C19H39F — CID 130342760
3-ethyl-2-fluoro-2,3,4,4,5,5,6,6-octamethylnonane (PubChem CID 130342760) has the molecular formula C19H39F and a molecular weight of 286.52 g/mol. Its IUPAC name is 3-ethyl-2-fluoro-2,3,4,4,5,5,6,6-octamethylnonane.
| Compound Name | 3-ethyl-2-fluoro-2,3,4,4,5,5,6,6-octamethylnonane |
|---|---|
| PubChem CID | 130342760 |
| Molecular Formula | C19H39F |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | 3-ethyl-2-fluoro-2,3,4,4,5,5,6,6-octamethylnonane |
| SMILES | CCCC(C)(C)C(C)(C)C(C)(C)C(C)(CC)C(C)(C)F |
| InChI | InChI=1S/C19H39F/c1-12-14-15(3,4)16(5,6)17(7,8)19(11,13-2)18(9,10)20/h12-14H2,1-11H3 |
| InChIKey | SMOSXTLIJYQBIQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |