C26H56 — CID 158030577
2,2,3,3,4,4-hexamethylhexane;2,2,3,4,4-pentamethyl-3-propan-2-ylhexane (PubChem CID 158030577) has the molecular formula C26H56 and a molecular weight of 368.73 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexamethylhexane;2,2,3,4,4-pentamethyl-3-propan-2-ylhexane.
| Compound Name | 2,2,3,3,4,4-hexamethylhexane;2,2,3,4,4-pentamethyl-3-propan-2-ylhexane |
|---|---|
| PubChem CID | 158030577 |
| Molecular Formula | C26H56 |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 368.44 |
| IUPAC Name | 2,2,3,3,4,4-hexamethylhexane;2,2,3,4,4-pentamethyl-3-propan-2-ylhexane |
| SMILES | CCC(C)(C)C(C)(C(C)C)C(C)(C)C.CCC(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30.C12H26/c1-10-13(7,8)14(9,11(2)3)12(4,5)6;1-9-11(5,6)12(7,8)10(2,3)4/h11H,10H2,1-9H3;9H2,1-8H3 |
| InChIKey | FHDBMKSCQFVCIN-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |