About 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane
4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane (PubChem CID 123480533) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane.
Analyze 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane?
The IUPAC name of 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane (CID 123480533) is 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane.
What is the SMILES notation for 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane?
The canonical SMILES for 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane is CCC(C)(C)C(C)(CC)C(C)(C(C)C)C(C)C.
What is the InChIKey of 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane?
The InChIKey is VQTMRNLOPPMOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36/c1-11-15(7,8)16(9,12-2)17(10,13(3)4)14(5)6/h13-14H,11-12H2,1-10H3.
What are the key properties of 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane?
4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane has a molecular weight of 240.47 g/mol, XLogP of 6.16, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3,4,5,5-pentamethyl-3-propan-2-ylheptane is sourced from PubChem (CID 123480533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).