C27H56 — CID 123187307
3,3,4,4,5,5,6,6,7,8,8,9,9,10,10-pentadecamethyldodecane (PubChem CID 123187307) has the molecular formula C27H56 and a molecular weight of 380.75 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,8,8,9,9,10,10-pentadecamethyldodecane.
| Compound Name | 3,3,4,4,5,5,6,6,7,8,8,9,9,10,10-pentadecamethyldodecane |
|---|---|
| PubChem CID | 123187307 |
| Molecular Formula | C27H56 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.44 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,8,8,9,9,10,10-pentadecamethyldodecane |
| SMILES | CCC(C)(C)C(C)(C)C(C)(C)C(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C27H56/c1-18-21(4,5)25(12,13)23(8,9)20(3)24(10,11)27(16,17)26(14,15)22(6,7)19-2/h20H,18-19H2,1-17H3 |
| InChIKey | VFJRZGDYRRZFCB-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |