C15H30I2 — CID 118200534
(3S)-4,4-diiodo-2,2,3,5,5,6,6-heptamethyloctane (PubChem CID 118200534) has the molecular formula C15H30I2 and a molecular weight of 464.21 g/mol. Its IUPAC name is (3S)-4,4-diiodo-2,2,3,5,5,6,6-heptamethyloctane.
| Compound Name | (3S)-4,4-diiodo-2,2,3,5,5,6,6-heptamethyloctane |
|---|---|
| PubChem CID | 118200534 |
| Molecular Formula | C15H30I2 |
| Molecular Weight | 464.21 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | (3S)-4,4-diiodo-2,2,3,5,5,6,6-heptamethyloctane |
| SMILES | CCC(C)(C)C(C)(C)C(I)(I)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C15H30I2/c1-10-13(6,7)14(8,9)15(16,17)11(2)12(3,4)5/h11H,10H2,1-9H3/t11-/m0/s1 |
| InChIKey | MTQMMWPBPXFMRR-NSHDSACASA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.21 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|