C18H38 — CID 123644711
5,5-diethyl-2,2,3,3,4,4,6-heptamethylheptane (PubChem CID 123644711) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is 5,5-diethyl-2,2,3,3,4,4,6-heptamethylheptane.
| Compound Name | 5,5-diethyl-2,2,3,3,4,4,6-heptamethylheptane |
|---|---|
| PubChem CID | 123644711 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 5,5-diethyl-2,2,3,3,4,4,6-heptamethylheptane |
| SMILES | CCC(CC)(C(C)C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38/c1-12-18(13-2,14(3)4)17(10,11)16(8,9)15(5,6)7/h14H,12-13H2,1-11H3 |
| InChIKey | PWUDFKJRTZHPBE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |