C21H44 — CID 58764501
2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonane (PubChem CID 58764501) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonane.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonane |
|---|---|
| PubChem CID | 58764501 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonane |
| SMILES | CC(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C21H44/c1-15(2)17(5,6)19(9,10)21(13,14)20(11,12)18(7,8)16(3)4/h15-16H,1-14H3 |
| InChIKey | JIVMARVWTBBLTF-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |