C18H37NO — CID 137490874
4,4,5,5,6,6,7-heptamethyl-1-nitroso-3-propan-2-yloctane (PubChem CID 137490874) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is 4,4,5,5,6,6,7-heptamethyl-1-nitroso-3-propan-2-yloctane.
| Compound Name | 4,4,5,5,6,6,7-heptamethyl-1-nitroso-3-propan-2-yloctane |
|---|---|
| PubChem CID | 137490874 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 4,4,5,5,6,6,7-heptamethyl-1-nitroso-3-propan-2-yloctane |
| SMILES | CC(C)C(CCN=O)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H37NO/c1-13(2)15(11-12-19-20)17(7,8)18(9,10)16(5,6)14(3)4/h13-15H,11-12H2,1-10H3 |
| InChIKey | SDJCLXYQVOTHPA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |