C4H7N3O3 — CID 121451530
(2S)-1,2,4-trinitrosobutane (PubChem CID 121451530) has the molecular formula C4H7N3O3 and a molecular weight of 145.12 g/mol. Its IUPAC name is (2S)-1,2,4-trinitrosobutane.
| Compound Name | (2S)-1,2,4-trinitrosobutane |
|---|---|
| PubChem CID | 121451530 |
| Molecular Formula | C4H7N3O3 |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | (2S)-1,2,4-trinitrosobutane |
| SMILES | O=NCC[C@@H](CN=O)N=O |
| InChI | InChI=1S/C4H7N3O3/c8-5-2-1-4(7-10)3-6-9/h4H,1-3H2/t4-/m0/s1 |
| InChIKey | KZERFKVPOQXLRH-BYPYZUCNSA-N |
| XLogP | 1.04 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |