C6H10N2O3 — CID 88888535
1,2-dinitroso-3-prop-2-enoxypropane (PubChem CID 88888535) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 1,2-dinitroso-3-prop-2-enoxypropane.
| Compound Name | 1,2-dinitroso-3-prop-2-enoxypropane |
|---|---|
| PubChem CID | 88888535 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1,2-dinitroso-3-prop-2-enoxypropane |
| SMILES | C=CCOCC(CN=O)N=O |
| InChI | InChI=1S/C6H10N2O3/c1-2-3-11-5-6(8-10)4-7-9/h2,6H,1,3-5H2 |
| InChIKey | GZMLGTQVGFFHDK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|