C18H30O4S2 — CID 170724372
2-[1,3-bis(prop-2-enoxy)propan-2-yldisulfanyl]-1,3-bis(prop-2-enoxy)propane (PubChem CID 170724372) has the molecular formula C18H30O4S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 2-[1,3-bis(prop-2-enoxy)propan-2-yldisulfanyl]-1,3-bis(prop-2-enoxy)propane.
| Compound Name | 2-[1,3-bis(prop-2-enoxy)propan-2-yldisulfanyl]-1,3-bis(prop-2-enoxy)propane |
|---|---|
| PubChem CID | 170724372 |
| Molecular Formula | C18H30O4S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[1,3-bis(prop-2-enoxy)propan-2-yldisulfanyl]-1,3-bis(prop-2-enoxy)propane |
| SMILES | C=CCOCC(COCC=C)SSC(COCC=C)COCC=C |
| InChI | InChI=1S/C18H30O4S2/c1-5-9-19-13-17(14-20-10-6-2)23-24-18(15-21-11-7-3)16-22-12-8-4/h5-8,17-18H,1-4,9-16H2 |
| InChIKey | PDINYWZCDQAJBQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|