About 4-nitrosohepta-1,6-diene
4-nitrosohepta-1,6-diene (PubChem CID 57286056) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 4-nitrosohepta-1,6-diene.
Molecular Properties
| Compound Name | 4-nitrosohepta-1,6-diene |
| PubChem CID | 57286056 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 4-nitrosohepta-1,6-diene |
| SMILES | C=CCC(CC=C)N=O |
| InChI | InChI=1S/C7H11NO/c1-3-5-7(8-9)6-4-2/h3-4,7H,1-2,5-6H2 |
| InChIKey | WFSBPYRIGGCDJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrosohepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrosohepta-1,6-diene?
The IUPAC name of 4-nitrosohepta-1,6-diene (CID 57286056) is 4-nitrosohepta-1,6-diene.
What is the SMILES notation for 4-nitrosohepta-1,6-diene?
The canonical SMILES for 4-nitrosohepta-1,6-diene is C=CCC(CC=C)N=O.
What is the InChIKey of 4-nitrosohepta-1,6-diene?
The InChIKey is WFSBPYRIGGCDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-5-7(8-9)6-4-2/h3-4,7H,1-2,5-6H2.
What are the key properties of 4-nitrosohepta-1,6-diene?
4-nitrosohepta-1,6-diene has a molecular weight of 125.17 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrosohepta-1,6-diene is sourced from PubChem (CID 57286056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).