C15H36OSi2 — CID 123336820
2,3,3,4,4,5,5,6-octamethylheptan-2-yl(silyloxy)silane (PubChem CID 123336820) has the molecular formula C15H36OSi2 and a molecular weight of 288.62 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octamethylheptan-2-yl(silyloxy)silane.
| Compound Name | 2,3,3,4,4,5,5,6-octamethylheptan-2-yl(silyloxy)silane |
|---|---|
| PubChem CID | 123336820 |
| Molecular Formula | C15H36OSi2 |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octamethylheptan-2-yl(silyloxy)silane |
| SMILES | CC(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C15H36OSi2/c1-11(2)12(3,4)13(5,6)14(7,8)15(9,10)18-16-17/h11H,18H2,1-10,17H3 |
| InChIKey | JLYFWKBWHYVBOH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|