C17H40OSi2 — CID 123878427
(2-tert-butyl-4,4-dimethylhexyl)-dimethyl-trimethylsilyloxysilane (PubChem CID 123878427) has the molecular formula C17H40OSi2 and a molecular weight of 316.68 g/mol. Its IUPAC name is (2-tert-butyl-4,4-dimethylhexyl)-dimethyl-trimethylsilyloxysilane.
| Compound Name | (2-tert-butyl-4,4-dimethylhexyl)-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123878427 |
| Molecular Formula | C17H40OSi2 |
| Molecular Weight | 316.68 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | (2-tert-butyl-4,4-dimethylhexyl)-dimethyl-trimethylsilyloxysilane |
| SMILES | CCC(C)(C)CC(C[Si](C)(C)O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H40OSi2/c1-12-17(5,6)13-15(16(2,3)4)14-20(10,11)18-19(7,8)9/h15H,12-14H2,1-11H3 |
| InChIKey | CDFPCBIDARKAOY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|