C20H46OSi2 — CID 123149684
[2-(2,2-dimethylpropyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane (PubChem CID 123149684) has the molecular formula C20H46OSi2 and a molecular weight of 358.76 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane.
| Compound Name | [2-(2,2-dimethylpropyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123149684 |
| Molecular Formula | C20H46OSi2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-3,4,5,5-tetramethylhexyl]-dimethyl-trimethylsilyloxysilane |
| SMILES | CC(C(CC(C)(C)C)C[Si](C)(C)O[Si](C)(C)C)C(C)C(C)(C)C |
| InChI | InChI=1S/C20H46OSi2/c1-16(17(2)20(6,7)8)18(14-19(3,4)5)15-23(12,13)21-22(9,10)11/h16-18H,14-15H2,1-13H3 |
| InChIKey | DEDQFSXJZOKLGM-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|