C19H39NO — CID 155457724
N-(4,4-dimethylpentan-2-yl)-2,2,4,4,5,5-hexamethylhexanamide (PubChem CID 155457724) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is N-(4,4-dimethylpentan-2-yl)-2,2,4,4,5,5-hexamethylhexanamide.
| Compound Name | N-(4,4-dimethylpentan-2-yl)-2,2,4,4,5,5-hexamethylhexanamide |
|---|---|
| PubChem CID | 155457724 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N-(4,4-dimethylpentan-2-yl)-2,2,4,4,5,5-hexamethylhexanamide |
| SMILES | CC(CC(C)(C)C)NC(=O)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39NO/c1-14(12-16(2,3)4)20-15(21)18(8,9)13-19(10,11)17(5,6)7/h14H,12-13H2,1-11H3,(H,20,21) |
| InChIKey | VLJXYQNNYBVGBU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |