C24H44N2O5S — CID 142428064
4-[3-(2,3-dihydroxypropylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-2,2-dimethyl-N-(2,4,4,5-tetramethylhexan-2-yl)pentanamide (PubChem CID 142428064) has the molecular formula C24H44N2O5S and a molecular weight of 472.69 g/mol. Its IUPAC name is 4-[3-(2,3-dihydroxypropylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-2,2-dimethyl-N-(2,4,4,5-tetramethylhexan-2-yl)pentanamide.
| Compound Name | 4-[3-(2,3-dihydroxypropylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-2,2-dimethyl-N-(2,4,4,5-tetramethylhexan-2-yl)pentanamide |
|---|---|
| PubChem CID | 142428064 |
| Molecular Formula | C24H44N2O5S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-[3-(2,3-dihydroxypropylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-2,2-dimethyl-N-(2,4,4,5-tetramethylhexan-2-yl)pentanamide |
| SMILES | CC(CC(C)(C)C(=O)NC(C)(C)CC(C)(C)C(C)C)N1C(=O)CC(SCC(O)CO)C1=O |
| InChI | InChI=1S/C24H44N2O5S/c1-15(2)23(6,7)14-24(8,9)25-21(31)22(4,5)11-16(3)26-19(29)10-18(20(26)30)32-13-17(28)12-27/h15-18,27-28H,10-14H2,1-9H3,(H,25,31) |
| InChIKey | IJPWZRUHVZTWKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|