C23H42N4O4S — CID 143938618
4-[3-(2-hydrazinyl-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide (PubChem CID 143938618) has the molecular formula C23H42N4O4S and a molecular weight of 470.68 g/mol. Its IUPAC name is 4-[3-(2-hydrazinyl-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide.
| Compound Name | 4-[3-(2-hydrazinyl-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
|---|---|
| PubChem CID | 143938618 |
| Molecular Formula | C23H42N4O4S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 4-[3-(2-hydrazinyl-3-oxopropyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)N1C(=O)CC(SCC(C=O)NN)C1=O |
| InChI | InChI=1S/C23H42N4O4S/c1-20(2,3)13-22(6,7)25-19(31)21(4,5)14-23(8,9)27-17(29)10-16(18(27)30)32-12-15(11-28)26-24/h11,15-16,26H,10,12-14,24H2,1-9H3,(H,25,31) |
| InChIKey | ZRTGWKTUBJELPA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|