C14H25N3O4S — CID 145189441
N-[1-(1-tert-butyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropan-2-yl]acetamide;formamide (PubChem CID 145189441) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropan-2-yl]acetamide;formamide.
| Compound Name | N-[1-(1-tert-butyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropan-2-yl]acetamide;formamide |
|---|---|
| PubChem CID | 145189441 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[1-(1-tert-butyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropan-2-yl]acetamide;formamide |
| SMILES | CC(=O)NC(C)CSC1CC(=O)N(C(C)(C)C)C1=O.NC=O |
| InChI | InChI=1S/C13H22N2O3S.CH3NO/c1-8(14-9(2)16)7-19-10-6-11(17)15(12(10)18)13(3,4)5;2-1-3/h8,10H,6-7H2,1-5H3,(H,14,16);1H,(H2,2,3) |
| InChIKey | BWRCUORKDAITSX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|